C18H16N6S2 — CID 133404754
2-ethyl-4-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine (PubChem CID 133404754) has the molecular formula C18H16N6S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-ethyl-4-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine.
| Compound Name | 2-ethyl-4-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133404754 |
| Molecular Formula | C18H16N6S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-ethyl-4-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidine |
| SMILES | C=CCn1c(Sc2nc(CC)nc3sccc23)nnc1-c1ccccn1 |
| InChI | InChI=1S/C18H16N6S2/c1-3-10-24-15(13-7-5-6-9-19-13)22-23-18(24)26-17-12-8-11-25-16(12)20-14(4-2)21-17/h3,5-9,11H,1,4,10H2,2H3 |
| InChIKey | UEUDYXRPYPJLTB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|