C17H15N5O2S — CID 1423711
2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 1423711) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 1423711 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | C=CCn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C17H15N5O2S/c1-2-11-21-16(15-5-3-4-10-18-15)19-20-17(21)25-12-13-6-8-14(9-7-13)22(23)24/h2-10H,1,11-12H2 |
| InChIKey | CWZRZRUGZHWFKL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|