C18H14N6O3S — CID 1248803
2-[4-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyrazine (PubChem CID 1248803) has the molecular formula C18H14N6O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[4-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyrazine.
| Compound Name | 2-[4-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 1248803 |
| Molecular Formula | C18H14N6O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[4-(furan-2-ylmethyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyrazine |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc(-c3cnccn3)n2Cc2ccco2)cc1 |
| InChI | InChI=1S/C18H14N6O3S/c25-24(26)14-5-3-13(4-6-14)12-28-18-22-21-17(16-10-19-7-8-20-16)23(18)11-15-2-1-9-27-15/h1-10H,11-12H2 |
| InChIKey | JIPOZOMPNJLJOG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|