C21H18N4O3S — CID 7989217
4-benzyl-3-(2-methylfuran-3-yl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 7989217) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-benzyl-3-(2-methylfuran-3-yl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-benzyl-3-(2-methylfuran-3-yl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 7989217 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-benzyl-3-(2-methylfuran-3-yl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1occc1-c1nnc(SCc2ccc([N+](=O)[O-])cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H18N4O3S/c1-15-19(11-12-28-15)20-22-23-21(24(20)13-16-5-3-2-4-6-16)29-14-17-7-9-18(10-8-17)25(26)27/h2-12H,13-14H2,1H3 |
| InChIKey | OZLLPPWQQMHKRP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|