C22H18N4O2S — CID 4596781
4-benzyl-3-benzylsulfanyl-5-(3-nitrophenyl)-1,2,4-triazole (PubChem CID 4596781) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-benzyl-3-benzylsulfanyl-5-(3-nitrophenyl)-1,2,4-triazole.
| Compound Name | 4-benzyl-3-benzylsulfanyl-5-(3-nitrophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 4596781 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-benzyl-3-benzylsulfanyl-5-(3-nitrophenyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc(SCc3ccccc3)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H18N4O2S/c27-26(28)20-13-7-12-19(14-20)21-23-24-22(29-16-18-10-5-2-6-11-18)25(21)15-17-8-3-1-4-9-17/h1-14H,15-16H2 |
| InChIKey | DLCQAGYGOXVLBF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|