C19H18N4O2S — CID 4788379
4-benzyl-3-cyclopropyl-5-[(3-nitrophenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 4788379) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-benzyl-3-cyclopropyl-5-[(3-nitrophenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-benzyl-3-cyclopropyl-5-[(3-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 4788379 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-benzyl-3-cyclopropyl-5-[(3-nitrophenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cccc(CSc2nnc(C3CC3)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4O2S/c24-23(25)17-8-4-7-15(11-17)13-26-19-21-20-18(16-9-10-16)22(19)12-14-5-2-1-3-6-14/h1-8,11,16H,9-10,12-13H2 |
| InChIKey | FDIRZJPOUSOBDP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|