C22H23N5O5S — CID 171395540
4-[4-benzyl-5-[(3,5-dinitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]cyclohexan-1-ol (PubChem CID 171395540) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-[4-benzyl-5-[(3,5-dinitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-benzyl-5-[(3,5-dinitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 171395540 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-[4-benzyl-5-[(3,5-dinitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cc(CSc2nnc(C3CCC(O)CC3)n2Cc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N5O5S/c28-20-8-6-17(7-9-20)21-23-24-22(25(21)13-15-4-2-1-3-5-15)33-14-16-10-18(26(29)30)12-19(11-16)27(31)32/h1-5,10-12,17,20,28H,6-9,13-14H2 |
| InChIKey | RWLMZVQDNLZSBQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|