C23H19N5O5S — CID 155554107
4-benzyl-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 155554107) has the molecular formula C23H19N5O5S and a molecular weight of 477.50 g/mol. Its IUPAC name is 4-benzyl-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-benzyl-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 155554107 |
| Molecular Formula | C23H19N5O5S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-benzyl-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-c2nnc(SCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N5O5S/c1-33-21-9-7-18(8-10-21)22-24-25-23(26(22)14-16-5-3-2-4-6-16)34-15-17-11-19(27(29)30)13-20(12-17)28(31)32/h2-13H,14-15H2,1H3 |
| InChIKey | VOFCQICJGLFEIY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 126.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|