C21H13Cl2N5O4S — CID 155559145
4-(3,4-dichlorophenyl)-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-phenyl-1,2,4-triazole (PubChem CID 155559145) has the molecular formula C21H13Cl2N5O4S and a molecular weight of 502.34 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-phenyl-1,2,4-triazole.
| Compound Name | 4-(3,4-dichlorophenyl)-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 155559145 |
| Molecular Formula | C21H13Cl2N5O4S |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-[(3,5-dinitrophenyl)methylsulfanyl]-5-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(CSc2nnc(-c3ccccc3)n2-c2ccc(Cl)c(Cl)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13Cl2N5O4S/c22-18-7-6-15(11-19(18)23)26-20(14-4-2-1-3-5-14)24-25-21(26)33-12-13-8-16(27(29)30)10-17(9-13)28(31)32/h1-11H,12H2 |
| InChIKey | UMPFBJCNBKSNGN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|