C24H18N6O3S — CID 37082918
2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 37082918) has the molecular formula C24H18N6O3S and a molecular weight of 470.51 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 37082918 |
| Molecular Formula | C24H18N6O3S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-n2c(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N6O3S/c1-16-7-11-19(12-8-16)29-22(17-5-3-2-4-6-17)26-28-24(29)34-15-21-25-27-23(33-21)18-9-13-20(14-10-18)30(31)32/h2-14H,15H2,1H3 |
| InChIKey | ZACZBEKOZKQJGO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|