C21H14N6O4S — CID 37284332
2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 37284332) has the molecular formula C21H14N6O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 37284332 |
| Molecular Formula | C21H14N6O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(CSc3nnc(-c4ccco4)n3-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H14N6O4S/c28-27(29)16-10-8-14(9-11-16)20-24-22-18(31-20)13-32-21-25-23-19(17-7-4-12-30-17)26(21)15-5-2-1-3-6-15/h1-12H,13H2 |
| InChIKey | PFUNOFUCCZUJBE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 125.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|