C20H13Cl2N5O2S — CID 16538426
3-[4-(3,4-dichlorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 16538426) has the molecular formula C20H13Cl2N5O2S and a molecular weight of 458.33 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[4-(3,4-dichlorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 16538426 |
| Molecular Formula | C20H13Cl2N5O2S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 3-[4-(3,4-dichlorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc(-c3cccnc3)n2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H13Cl2N5O2S/c21-17-8-7-16(10-18(17)22)26-19(14-2-1-9-23-11-14)24-25-20(26)30-12-13-3-5-15(6-4-13)27(28)29/h1-11H,12H2 |
| InChIKey | AKYBUMIIJVKADN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|