C20H11Cl2N7O2S — CID 24565826
2-[[4-(3,4-dichlorophenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-3-nitroimidazo[1,2-a]pyridine (PubChem CID 24565826) has the molecular formula C20H11Cl2N7O2S and a molecular weight of 484.33 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-3-nitroimidazo[1,2-a]pyridine.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-3-nitroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 24565826 |
| Molecular Formula | C20H11Cl2N7O2S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-3-nitroimidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1c(Sc2nnc(-c3cccnc3)n2-c2ccc(Cl)c(Cl)c2)nc2ccccn12 |
| InChI | InChI=1S/C20H11Cl2N7O2S/c21-14-7-6-13(10-15(14)22)28-17(12-4-3-8-23-11-12)25-26-20(28)32-18-19(29(30)31)27-9-2-1-5-16(27)24-18/h1-11H |
| InChIKey | RYJRTQXXENYOGM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|