C23H21N3O2S — CID 7149439
3-benzylsulfanyl-4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazole (PubChem CID 7149439) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 7149439 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-benzylsulfanyl-4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazole |
| SMILES | COc1ccc(-n2c(SCc3ccccc3)nnc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H21N3O2S/c1-27-20-14-13-19(15-21(20)28-2)26-22(18-11-7-4-8-12-18)24-25-23(26)29-16-17-9-5-3-6-10-17/h3-15H,16H2,1-2H3 |
| InChIKey | UOVAXPYWJSFMSP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |