C23H21N3S — CID 42799320
3-benzylsulfanyl-4,5-bis(3-methylphenyl)-1,2,4-triazole (PubChem CID 42799320) has the molecular formula C23H21N3S and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-benzylsulfanyl-4,5-bis(3-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-4,5-bis(3-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 42799320 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-benzylsulfanyl-4,5-bis(3-methylphenyl)-1,2,4-triazole |
| SMILES | Cc1cccc(-c2nnc(SCc3ccccc3)n2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H21N3S/c1-17-8-6-12-20(14-17)22-24-25-23(27-16-19-10-4-3-5-11-19)26(22)21-13-7-9-18(2)15-21/h3-15H,16H2,1-2H3 |
| InChIKey | TYFXVDAUYCCWHA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |