C27H25N5O3S — CID 23605894
3-(2,5-dimethoxyphenyl)-5-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 23605894) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-5-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2,5-dimethoxyphenyl)-5-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 23605894 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-5-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(OC)c(-c2noc(CSc3nnc(-c4ccccc4)n3-c3ccc(C)c(C)c3)n2)c1 |
| InChI | InChI=1S/C27H25N5O3S/c1-17-10-11-20(14-18(17)2)32-26(19-8-6-5-7-9-19)29-30-27(32)36-16-24-28-25(31-35-24)22-15-21(33-3)12-13-23(22)34-4/h5-15H,16H2,1-4H3 |
| InChIKey | UOTVFOZDORFUCE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |