C25H20N4O4S — CID 4983426
2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione (PubChem CID 4983426) has the molecular formula C25H20N4O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4983426 |
| Molecular Formula | C25H20N4O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-n2c(SCN3C(=O)c4ccccc4C3=O)nnc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H20N4O4S/c1-32-20-13-12-17(14-21(20)33-2)29-22(16-8-4-3-5-9-16)26-27-25(29)34-15-28-23(30)18-10-6-7-11-19(18)24(28)31/h3-14H,15H2,1-2H3 |
| InChIKey | MFQGJUAMIHPANQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|