C23H16N4O3S — CID 137144429
2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione (PubChem CID 137144429) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137144429 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nnc(-c2ccccc2O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H16N4O3S/c28-19-13-7-6-12-18(19)20-24-25-23(27(20)15-8-2-1-3-9-15)31-14-26-21(29)16-10-4-5-11-17(16)22(26)30/h1-13,28H,14H2 |
| InChIKey | SVBKWHISSQGSOU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|