C25H16ClN5O2S — CID 135710288
2-[[4-(4-chlorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione (PubChem CID 135710288) has the molecular formula C25H16ClN5O2S and a molecular weight of 485.96 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135710288 |
| Molecular Formula | C25H16ClN5O2S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nnc(-c2c[nH]c3ccccc23)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16ClN5O2S/c26-15-9-11-16(12-10-15)31-22(20-13-27-21-8-4-3-5-17(20)21)28-29-25(31)34-14-30-23(32)18-6-1-2-7-19(18)24(30)33/h1-13,27H,14H2 |
| InChIKey | VMWKEAJGUUMDBV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|