C22H17IN4O2S — CID 137094273
2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 137094273) has the molecular formula C22H17IN4O2S and a molecular weight of 528.38 g/mol. Its IUPAC name is 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 137094273 |
| Molecular Formula | C22H17IN4O2S |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 528.01 |
| IUPAC Name | 2-[[5-(2-hydroxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2O)n1-c1ccccc1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C22H17IN4O2S/c23-15-7-6-8-16(13-15)24-20(29)14-30-22-26-25-21(18-11-4-5-12-19(18)28)27(22)17-9-2-1-3-10-17/h1-13,28H,14H2,(H,24,29) |
| InChIKey | JSXJUYLSYIIVFI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|