C24H21IN4O2S — CID 137058655
2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 137058655) has the molecular formula C24H21IN4O2S and a molecular weight of 556.43 g/mol. Its IUPAC name is 2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 137058655 |
| Molecular Formula | C24H21IN4O2S |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cccc(I)c3)nnc2-c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C24H21IN4O2S/c1-15-10-11-20(16(2)12-15)29-23(19-8-3-4-9-21(19)30)27-28-24(29)32-14-22(31)26-18-7-5-6-17(25)13-18/h3-13,30H,14H2,1-2H3,(H,26,31) |
| InChIKey | LOZPPLCXLIFJAK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|