C20H23IN5OS+ — CID 2517981
[(1R)-1-[5-[2-(3-iodoanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]ethyl]-dimethylazanium (PubChem CID 2517981) has the molecular formula C20H23IN5OS+ and a molecular weight of 508.41 g/mol. Its IUPAC name is [(1R)-1-[5-[2-(3-iodoanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[5-[2-(3-iodoanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2517981 |
| Molecular Formula | C20H23IN5OS+ |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | [(1R)-1-[5-[2-(3-iodoanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]ethyl]-dimethylazanium |
| SMILES | C[C@H](c1nnc(SCC(=O)Nc2cccc(I)c2)n1-c1ccccc1)[NH+](C)C |
| InChI | InChI=1S/C20H22IN5OS/c1-14(25(2)3)19-23-24-20(26(19)17-10-5-4-6-11-17)28-13-18(27)22-16-9-7-8-15(21)12-16/h4-12,14H,13H2,1-3H3,(H,22,27)/p+1/t14-/m1/s1 |
| InChIKey | SCRQPEZZERCBEZ-CQSZACIVSA-O |
| XLogP | 2.81 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|