C34H30N8O4S2 — CID 4675792
2-[[5-[2-[5-(2-anilino-2-oxoethyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]-1,2-dihydroxyethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 4675792) has the molecular formula C34H30N8O4S2 and a molecular weight of 678.80 g/mol. Its IUPAC name is 2-[[5-[2-[5-(2-anilino-2-oxoethyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]-1,2-dihydroxyethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[2-[5-(2-anilino-2-oxoethyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]-1,2-dihydroxyethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 4675792 |
| Molecular Formula | C34H30N8O4S2 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | 2-[[5-[2-[5-(2-anilino-2-oxoethyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]-1,2-dihydroxyethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | O=C(CSc1nnc(C(O)C(O)c2nnc(SCC(=O)Nc3ccccc3)n2-c2ccccc2)n1-c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C34H30N8O4S2/c43-27(35-23-13-5-1-6-14-23)21-47-33-39-37-31(41(33)25-17-9-3-10-18-25)29(45)30(46)32-38-40-34(42(32)26-19-11-4-12-20-26)48-22-28(44)36-24-15-7-2-8-16-24/h1-20,29-30,45-46H,21-22H2,(H,35,43)(H,36,44) |
| InChIKey | WZIRHVMMLIROQW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |