C21H22N4O3S — CID 2606719
2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 2606719) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 2606719 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[[4-(3,4-dimethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O3S/c1-4-12-22-19(26)14-29-21-24-23-20(15-8-6-5-7-9-15)25(21)16-10-11-17(27-2)18(13-16)28-3/h4-11,13H,1,12,14H2,2-3H3,(H,22,26) |
| InChIKey | XABYTTREVIGSCG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|