C25H21N5O5S — CID 2192190
methyl 2-[[2-[[4-benzyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 2192190) has the molecular formula C25H21N5O5S and a molecular weight of 503.54 g/mol. Its IUPAC name is methyl 2-[[2-[[4-benzyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[4-benzyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2192190 |
| Molecular Formula | C25H21N5O5S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | methyl 2-[[2-[[4-benzyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H21N5O5S/c1-35-24(32)20-9-5-6-10-21(20)26-22(31)16-36-25-28-27-23(18-11-13-19(14-12-18)30(33)34)29(25)15-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3,(H,26,31) |
| InChIKey | HHRZMYWZYGGOGH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|