C24H17FN6O3S — CID 4841760
2-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyano-4-nitrophenyl)acetamide (PubChem CID 4841760) has the molecular formula C24H17FN6O3S and a molecular weight of 488.50 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyano-4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyano-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4841760 |
| Molecular Formula | C24H17FN6O3S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[[4-benzyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyano-4-nitrophenyl)acetamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(-c2ccccc2F)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H17FN6O3S/c25-20-9-5-4-8-19(20)23-28-29-24(30(23)14-16-6-2-1-3-7-16)35-15-22(32)27-21-11-10-18(31(33)34)12-17(21)13-26/h1-12H,14-15H2,(H,27,32) |
| InChIKey | DZAIDUXPKVDOAF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|