C18H18N4O3S — CID 31669267
4-benzyl-3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5-methyl-1,2,4-triazole (PubChem CID 31669267) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-benzyl-3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5-methyl-1,2,4-triazole.
| Compound Name | 4-benzyl-3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 31669267 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-benzyl-3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5-methyl-1,2,4-triazole |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nnc(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-13-19-20-18(21(13)11-14-6-4-3-5-7-14)26-12-15-10-16(22(23)24)8-9-17(15)25-2/h3-10H,11-12H2,1-2H3 |
| InChIKey | OATZERPNCOTQAZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|