C23H22N4O3S2 — CID 42983433
3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole (PubChem CID 42983433) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 42983433 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nnc(Cc2cccs2)n1CCc1ccccc1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-30-21-10-9-19(27(28)29)14-18(21)16-32-23-25-24-22(15-20-8-5-13-31-20)26(23)12-11-17-6-3-2-4-7-17/h2-10,13-14H,11-12,15-16H2,1H3 |
| InChIKey | WIHXFFJZVCDBNB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|