C17H16N4O4S2 — CID 7742437
4-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole (PubChem CID 7742437) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 4-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 7742437 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
| SMILES | Cn1c(Cc2cccs2)nnc1SCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C17H16N4O4S2/c1-20-15(7-14-3-2-4-26-14)18-19-17(20)27-9-12-6-13(21(22)23)5-11-8-24-10-25-16(11)12/h2-6H,7-10H2,1H3 |
| InChIKey | LFWMMGWJAUFOOL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|