C17H17NO4S — CID 2498567
8-[(2-methylphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 2498567) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 8-[(2-methylphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(2-methylphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 2498567 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 8-[(2-methylphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | Cc1ccccc1CSCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C17H17NO4S/c1-12-4-2-3-5-13(12)9-23-10-15-7-16(18(19)20)6-14-8-21-11-22-17(14)15/h2-7H,8-11H2,1H3 |
| InChIKey | GANXMWUFQWTDFH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|