C17H16FNO5S — CID 18170850
8-[(3-fluoro-4-methoxyphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 18170850) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is 8-[(3-fluoro-4-methoxyphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(3-fluoro-4-methoxyphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 18170850 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 8-[(3-fluoro-4-methoxyphenyl)methylsulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | COc1ccc(CSCc2cc([N+](=O)[O-])cc3c2OCOC3)cc1F |
| InChI | InChI=1S/C17H16FNO5S/c1-22-16-3-2-11(4-15(16)18)8-25-9-13-6-14(19(20)21)5-12-7-23-10-24-17(12)13/h2-6H,7-10H2,1H3 |
| InChIKey | WJVGDUIMNQYAGW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|