C15H12FNO5 — CID 7894305
8-[(4-fluorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 7894305) has the molecular formula C15H12FNO5 and a molecular weight of 305.26 g/mol. Its IUPAC name is 8-[(4-fluorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(4-fluorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 7894305 |
| Molecular Formula | C15H12FNO5 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 8-[(4-fluorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(c(COc3ccc(F)cc3)c1)OCOC2 |
| InChI | InChI=1S/C15H12FNO5/c16-12-1-3-14(4-2-12)21-8-11-6-13(17(18)19)5-10-7-20-9-22-15(10)11/h1-6H,7-9H2 |
| InChIKey | MCZYBIFQUKRHOP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|