C21H21NO8 — CID 7133064
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-ethoxyphenyl)-4-oxobutanoate (PubChem CID 7133064) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-ethoxyphenyl)-4-oxobutanoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-ethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7133064 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-ethoxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1ccc(C(=O)CCC(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)cc1 |
| InChI | InChI=1S/C21H21NO8/c1-2-28-18-5-3-14(4-6-18)19(23)7-8-20(24)29-12-16-10-17(22(25)26)9-15-11-27-13-30-21(15)16/h3-6,9-10H,2,7-8,11-13H2,1H3 |
| InChIKey | FRMFOENIVMGXFV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|