C20H19N3O7 — CID 9086485
4-ethoxy-N'-[(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoyl]benzohydrazide (PubChem CID 9086485) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-ethoxy-N'-[(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-ethoxy-N'-[(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9086485 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-ethoxy-N'-[(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)/C=C/c2cc([N+](=O)[O-])cc3c2OCOC3)cc1 |
| InChI | InChI=1S/C20H19N3O7/c1-2-29-17-6-3-13(4-7-17)20(25)22-21-18(24)8-5-14-9-16(23(26)27)10-15-11-28-12-30-19(14)15/h3-10H,2,11-12H2,1H3,(H,21,24)(H,22,25)/b8-5+ |
| InChIKey | PITMGRQEUZPQQC-VMPITWQZSA-N |
| XLogP | 2.33 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|