C21H22N2O5 — CID 24563609
(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(4-phenylbutyl)prop-2-enamide (PubChem CID 24563609) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(4-phenylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(4-phenylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 24563609 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(4-phenylbutyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc([N+](=O)[O-])cc2c1OCOC2)NCCCCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O5/c24-20(22-11-5-4-8-16-6-2-1-3-7-16)10-9-17-12-19(23(25)26)13-18-14-27-15-28-21(17)18/h1-3,6-7,9-10,12-13H,4-5,8,11,14-15H2,(H,22,24)/b10-9+ |
| InChIKey | YHAOEDZJMQAKPR-MDZDMXLPSA-N |
| XLogP | 3.61 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|