C19H18N2O5S — CID 8529568
(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(2-phenylsulfanylethyl)prop-2-enamide (PubChem CID 8529568) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(2-phenylsulfanylethyl)prop-2-enamide.
| Compound Name | (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(2-phenylsulfanylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 8529568 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)-N-(2-phenylsulfanylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc([N+](=O)[O-])cc2c1OCOC2)NCCSc1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S/c22-18(20-8-9-27-17-4-2-1-3-5-17)7-6-14-10-16(21(23)24)11-15-12-25-13-26-19(14)15/h1-7,10-11H,8-9,12-13H2,(H,20,22)/b7-6+ |
| InChIKey | RZHZZXHFTTYXCV-VOTSOKGWSA-N |
| XLogP | 3.38 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|