C24H29N3O5 — CID 51727275
(E)-N-[(2S)-2-(diethylamino)-3-phenylpropyl]-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide (PubChem CID 51727275) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(diethylamino)-3-phenylpropyl]-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2S)-2-(diethylamino)-3-phenylpropyl]-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51727275 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (E)-N-[(2S)-2-(diethylamino)-3-phenylpropyl]-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
| SMILES | CCN(CC)[C@H](CNC(=O)/C=C/c1cc([N+](=O)[O-])cc2c1OCOC2)Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O5/c1-3-26(4-2)22(12-18-8-6-5-7-9-18)15-25-23(28)11-10-19-13-21(27(29)30)14-20-16-31-17-32-24(19)20/h5-11,13-14,22H,3-4,12,15-17H2,1-2H3,(H,25,28)/b11-10+/t22-/m0/s1 |
| InChIKey | BFAHEGXPSAPCCR-NEQMZLFVSA-N |
| XLogP | 3.54 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|