C18H17NO5S2 — CID 7706279
8-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 7706279) has the molecular formula C18H17NO5S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 8-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 7706279 |
| Molecular Formula | C18H17NO5S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 8-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(c(COc3ccc(C4SCCS4)cc3)c1)OCOC2 |
| InChI | InChI=1S/C18H17NO5S2/c20-19(21)15-7-13-9-22-11-24-17(13)14(8-15)10-23-16-3-1-12(2-4-16)18-25-5-6-26-18/h1-4,7-8,18H,5-6,9-11H2 |
| InChIKey | RPEZNJJOSAMOHU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|