C15H11Cl2NO5 — CID 2407612
8-[(2,5-dichlorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 2407612) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is 8-[(2,5-dichlorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(2,5-dichlorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 2407612 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 8-[(2,5-dichlorophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(c(COc3cc(Cl)ccc3Cl)c1)OCOC2 |
| InChI | InChI=1S/C15H11Cl2NO5/c16-11-1-2-13(17)14(5-11)22-7-10-4-12(18(19)20)3-9-6-21-8-23-15(9)10/h1-5H,6-8H2 |
| InChIKey | CSEBAXPKCNDIET-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|