C15H11ClN2O6 — CID 24524559
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-chloropyridine-4-carboxylate (PubChem CID 24524559) has the molecular formula C15H11ClN2O6 and a molecular weight of 350.71 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-chloropyridine-4-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 24524559 |
| Molecular Formula | C15H11ClN2O6 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-chloropyridine-4-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C15H11ClN2O6/c16-13-5-9(1-2-17-13)15(19)23-7-11-4-12(18(20)21)3-10-6-22-8-24-14(10)11/h1-5H,6-8H2 |
| InChIKey | GEJZWYGFZYIGJR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|