C21H18ClN3O6 — CID 71905357
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 71905357) has the molecular formula C21H18ClN3O6 and a molecular weight of 443.84 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 71905357 |
| Molecular Formula | C21H18ClN3O6 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1nn(-c2ccc(C(=O)OCc3cc([N+](=O)[O-])cc4c3OCOC4)cc2)c(C)c1Cl |
| InChI | InChI=1S/C21H18ClN3O6/c1-12-19(22)13(2)24(23-12)17-5-3-14(4-6-17)21(26)30-10-16-8-18(25(27)28)7-15-9-29-11-31-20(15)16/h3-8H,9-11H2,1-2H3 |
| InChIKey | BGKKGPRIUYVRBP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|