C24H22N2O8S — CID 16958620
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 16958620) has the molecular formula C24H22N2O8S and a molecular weight of 498.51 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16958620 |
| Molecular Formula | C24H22N2O8S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)OCc3cc([N+](=O)[O-])cc4c3OCOC4)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O8S/c1-16-3-9-22(10-4-16)35(30,31)25(2)20-7-5-17(6-8-20)24(27)33-14-19-12-21(26(28)29)11-18-13-32-15-34-23(18)19/h3-12H,13-15H2,1-2H3 |
| InChIKey | KMFSHXOMHKDTDX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|