C16H11F2NO6 — CID 2645620
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2,6-difluorobenzoate (PubChem CID 2645620) has the molecular formula C16H11F2NO6 and a molecular weight of 351.26 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2,6-difluorobenzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2645620 |
| Molecular Formula | C16H11F2NO6 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2,6-difluorobenzoate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1c(F)cccc1F |
| InChI | InChI=1S/C16H11F2NO6/c17-12-2-1-3-13(18)14(12)16(20)24-7-10-5-11(19(21)22)4-9-6-23-8-25-15(9)10/h1-5H,6-8H2 |
| InChIKey | ZGZWVNPIZMMQGA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|