C22H20N2O6 — CID 8536483
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-ethyl-4-methylquinoline-3-carboxylate (PubChem CID 8536483) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-ethyl-4-methylquinoline-3-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-ethyl-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8536483 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-ethyl-4-methylquinoline-3-carboxylate |
| SMILES | CCc1nc2ccccc2c(C)c1C(=O)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C22H20N2O6/c1-3-18-20(13(2)17-6-4-5-7-19(17)23-18)22(25)29-11-15-9-16(24(26)27)8-14-10-28-12-30-21(14)15/h4-9H,3,10-12H2,1-2H3 |
| InChIKey | BPLHCQLHUXGUCB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|