C18H14N2O6 — CID 7713490
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1H-indole-2-carboxylate (PubChem CID 7713490) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1H-indole-2-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7713490 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1H-indole-2-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H14N2O6/c21-18(16-7-11-3-1-2-4-15(11)19-16)25-9-13-6-14(20(22)23)5-12-8-24-10-26-17(12)13/h1-7,19H,8-10H2 |
| InChIKey | ALFNFSNWGQHTCO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|