C21H17NO9S — CID 55467160
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55467160) has the molecular formula C21H17NO9S and a molecular weight of 459.43 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55467160 |
| Molecular Formula | C21H17NO9S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17NO9S/c23-21(20-14(6-7-29-20)12-32(26,27)18-4-2-1-3-5-18)30-11-16-9-17(22(24)25)8-15-10-28-13-31-19(15)16/h1-9H,10-13H2 |
| InChIKey | NSWCEYDDEPCEDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 135.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|