C21H21NO8S — CID 46693875
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1-(benzenesulfonyl)cyclopentane-1-carboxylate (PubChem CID 46693875) has the molecular formula C21H21NO8S and a molecular weight of 447.47 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1-(benzenesulfonyl)cyclopentane-1-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1-(benzenesulfonyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 46693875 |
| Molecular Formula | C21H21NO8S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 1-(benzenesulfonyl)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)C1(S(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H21NO8S/c23-20(21(8-4-5-9-21)31(26,27)18-6-2-1-3-7-18)29-13-16-11-17(22(24)25)10-15-12-28-14-30-19(15)16/h1-3,6-7,10-11H,4-5,8-9,12-14H2 |
| InChIKey | TVUPZOLLIYNLBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|