C26H20N2O8 — CID 18774797
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 18774797) has the molecular formula C26H20N2O8 and a molecular weight of 488.45 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 18774797 |
| Molecular Formula | C26H20N2O8 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H20N2O8/c29-24-20-8-4-5-9-21(20)25(30)27(24)22(10-16-6-2-1-3-7-16)26(31)35-14-18-12-19(28(32)33)11-17-13-34-15-36-23(17)18/h1-9,11-12,22H,10,13-15H2/t22-/m0/s1 |
| InChIKey | OUPVEGHGGXYVCS-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|