C23H22N2O4 — CID 16595049
N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1,2-diphenylethanamine (PubChem CID 16595049) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1,2-diphenylethanamine.
| Compound Name | N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 16595049 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-1,2-diphenylethanamine |
| SMILES | O=[N+]([O-])c1cc(CNC(Cc2ccccc2)c2ccccc2)c2c(c1)COCO2 |
| InChI | InChI=1S/C23H22N2O4/c26-25(27)21-12-19(23-20(13-21)15-28-16-29-23)14-24-22(18-9-5-2-6-10-18)11-17-7-3-1-4-8-17/h1-10,12-13,22,24H,11,14-16H2 |
| InChIKey | BVMAYOJLVIJQLU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|