C15H12FNO4S — CID 2647704
8-[(4-fluorophenyl)sulfanylmethyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 2647704) has the molecular formula C15H12FNO4S and a molecular weight of 321.33 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)sulfanylmethyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(4-fluorophenyl)sulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 2647704 |
| Molecular Formula | C15H12FNO4S |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 8-[(4-fluorophenyl)sulfanylmethyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(c(CSc3ccc(F)cc3)c1)OCOC2 |
| InChI | InChI=1S/C15H12FNO4S/c16-12-1-3-14(4-2-12)22-8-11-6-13(17(18)19)5-10-7-20-9-21-15(10)11/h1-6H,7-9H2 |
| InChIKey | KQSKZPVVHPMMQB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|